![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Applied Geo.pdf | 2026-09-18 17:16 | 232K | |
| Architecture.pdf | 2026-09-18 17:16 | 239K | |
| BioTech.pdf | 2026-09-18 17:16 | 240K | |
| Biomedical.pdf | 2026-09-18 17:16 | 239K | |
| Chemical.pdf | 2026-09-18 17:16 | 236K | |
| Chemistry.pdf | 2026-09-18 17:16 | 245K | |
| Civil.pdf | 2026-09-18 17:16 | 232K | |
| Computer Science and Engineering.pdf | 2026-09-18 17:16 | 243K | |
| Computer_Applications.pdf | 2026-09-18 17:16 | 240K | |
| Elecronics and Communication.pdf | 2026-09-18 17:16 | 242K | |
| Electrical.pdf | 2026-09-18 17:16 | 238K | |
| Humanities and SS.pdf | 2026-09-18 17:16 | 242K | |
| Information Technology.pdf | 2026-09-18 17:16 | 239K | |
| Mathematics.pdf | 2026-09-18 17:16 | 247K | |
| Mechanical.pdf | 2026-09-18 17:16 | 230K | |
| Metallurgical and Materials Engg.pdf | 2026-09-18 17:16 | 234K | |
| Mining Engineering.pdf | 2026-09-18 17:16 | 233K | |
| Physics.pdf | 2026-09-18 17:16 | 238K | |